C19H24BrNO2S — CID 56642313
2-bromo-4-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine (PubChem CID 56642313) has the molecular formula C19H24BrNO2S and a molecular weight of 410.38 g/mol. Its IUPAC name is 2-bromo-4-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine.
| Compound Name | 2-bromo-4-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine |
|---|---|
| PubChem CID | 56642313 |
| Molecular Formula | C19H24BrNO2S |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-bromo-4-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)pyridine |
| SMILES | CCCCCCCCc1sc(-c2ccnc(Br)c2)c2c1OCCO2 |
| InChI | InChI=1S/C19H24BrNO2S/c1-2-3-4-5-6-7-8-15-17-18(23-12-11-22-17)19(24-15)14-9-10-21-16(20)13-14/h9-10,13H,2-8,11-12H2,1H3 |
| InChIKey | HLAKSRZQBUCHGI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|