C18H13BF2N2O3 — CID 56642691
2,2-difluoro-8-(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene-4,12-dicarbaldehyde (PubChem CID 56642691) has the molecular formula C18H13BF2N2O3 and a molecular weight of 354.12 g/mol. Its IUPAC name is 2,2-difluoro-8-(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene-4,12-dicarbaldehyde.
| Compound Name | 2,2-difluoro-8-(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene-4,12-dicarbaldehyde |
|---|---|
| PubChem CID | 56642691 |
| Molecular Formula | C18H13BF2N2O3 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2,2-difluoro-8-(4-methoxyphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene-4,12-dicarbaldehyde |
| SMILES | COc1ccc(C2=C3C=CC(C=O)=[N+]3[B-](F)(F)n3c(C=O)ccc32)cc1 |
| InChI | InChI=1S/C18H13BF2N2O3/c1-26-15-6-2-12(3-7-15)18-16-8-4-13(10-24)22(16)19(20,21)23-14(11-25)5-9-17(18)23/h2-11H,1H3 |
| InChIKey | UPQURIUYJINSFE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|