C27H54O3Si2 — CID 56642712
tert-butyl-[(2S,3E,5E,7S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethylundeca-3,5,10-trienoxy]-dimethylsilane (PubChem CID 56642712) has the molecular formula C27H54O3Si2 and a molecular weight of 482.90 g/mol. Its IUPAC name is tert-butyl-[(2S,3E,5E,7S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethylundeca-3,5,10-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3E,5E,7S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethylundeca-3,5,10-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 56642712 |
| Molecular Formula | C27H54O3Si2 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | tert-butyl-[(2S,3E,5E,7S,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-2,6,8-trimethylundeca-3,5,10-trienoxy]-dimethylsilane |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OC)/C(C)=C/C=C/[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O3Si2/c1-16-24(30-32(14,15)27(8,9)10)23(4)25(28-11)22(3)19-17-18-21(2)20-29-31(12,13)26(5,6)7/h16-19,21,23-25H,1,20H2,2-15H3/b18-17+,22-19+/t21-,23-,24+,25+/m0/s1 |
| InChIKey | YDWMYXNVQZOZDW-YPDWUNILSA-N |
| XLogP | 8.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|