About (6S,7S)-7,11-dimethyldodec-10-en-6-ol
(6S,7S)-7,11-dimethyldodec-10-en-6-ol (PubChem CID 56642773) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is (6S,7S)-7,11-dimethyldodec-10-en-6-ol.
Molecular Properties
| Compound Name | (6S,7S)-7,11-dimethyldodec-10-en-6-ol |
| PubChem CID | 56642773 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (6S,7S)-7,11-dimethyldodec-10-en-6-ol |
| SMILES | CCCCC[C@H](O)[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C14H28O/c1-5-6-7-11-14(15)13(4)10-8-9-12(2)3/h9,13-15H,5-8,10-11H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | VCRJWTIOKBKQJP-KBPBESRZSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S,7S)-7,11-dimethyldodec-10-en-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S,7S)-7,11-dimethyldodec-10-en-6-ol?
The IUPAC name of (6S,7S)-7,11-dimethyldodec-10-en-6-ol (CID 56642773) is (6S,7S)-7,11-dimethyldodec-10-en-6-ol.
What is the SMILES notation for (6S,7S)-7,11-dimethyldodec-10-en-6-ol?
The canonical SMILES for (6S,7S)-7,11-dimethyldodec-10-en-6-ol is CCCCC[C@H](O)[C@@H](C)CCC=C(C)C.
What is the InChIKey of (6S,7S)-7,11-dimethyldodec-10-en-6-ol?
The InChIKey is VCRJWTIOKBKQJP-KBPBESRZSA-N. The full InChI is InChI=1S/C14H28O/c1-5-6-7-11-14(15)13(4)10-8-9-12(2)3/h9,13-15H,5-8,10-11H2,1-4H3/t13-,14-/m0/s1.
What are the key properties of (6S,7S)-7,11-dimethyldodec-10-en-6-ol?
(6S,7S)-7,11-dimethyldodec-10-en-6-ol has a molecular weight of 212.38 g/mol, XLogP of 4.31, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S,7S)-7,11-dimethyldodec-10-en-6-ol is sourced from PubChem (CID 56642773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).