C15H18ClN3S — CID 56642823
N-[(E)-1-phenylethylideneamino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride (PubChem CID 56642823) has the molecular formula C15H18ClN3S and a molecular weight of 307.85 g/mol. Its IUPAC name is N-[(E)-1-phenylethylideneamino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride.
| Compound Name | N-[(E)-1-phenylethylideneamino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 56642823 |
| Molecular Formula | C15H18ClN3S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-[(E)-1-phenylethylideneamino]-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine;hydrochloride |
| SMILES | C/C(=N\Nc1nc2c(s1)CCCC2)c1ccccc1.Cl |
| InChI | InChI=1S/C15H17N3S.ClH/c1-11(12-7-3-2-4-8-12)17-18-15-16-13-9-5-6-10-14(13)19-15;/h2-4,7-8H,5-6,9-10H2,1H3,(H,16,18);1H/b17-11+; |
| InChIKey | GUERAMKHLWQIEJ-SJDTYFKWSA-N |
| XLogP | 4.28 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|