C10H13ClN6 — CID 56642855
3-N-[(E)-(4-methylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 56642855) has the molecular formula C10H13ClN6 and a molecular weight of 252.71 g/mol. Its IUPAC name is 3-N-[(E)-(4-methylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(E)-(4-methylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 56642855 |
| Molecular Formula | C10H13ClN6 |
| Molecular Weight | 252.71 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-N-[(E)-(4-methylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | Cc1ccc(/C=N/Nc2nncn2N)cc1.Cl |
| InChI | InChI=1S/C10H12N6.ClH/c1-8-2-4-9(5-3-8)6-12-14-10-15-13-7-16(10)11;/h2-7H,11H2,1H3,(H,14,15);1H/b12-6+; |
| InChIKey | GSWNZAJSSRYKGD-WXIWBVQFSA-N |
| XLogP | 1.17 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.71 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|