C17H17Cl3N6O — CID 56642923
3-N-[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 56642923) has the molecular formula C17H17Cl3N6O and a molecular weight of 427.72 g/mol. Its IUPAC name is 3-N-[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 56642923 |
| Molecular Formula | C17H17Cl3N6O |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 3-N-[(E)-[3-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | Cc1nnc(N/N=C/c2cccc(OCc3ccc(Cl)c(Cl)c3)c2)n1N.Cl |
| InChI | InChI=1S/C17H16Cl2N6O.ClH/c1-11-22-24-17(25(11)20)23-21-9-12-3-2-4-14(7-12)26-10-13-5-6-15(18)16(19)8-13;/h2-9H,10,20H2,1H3,(H,23,24);1H/b21-9+; |
| InChIKey | ZHOWYGHZCHBCEC-CSFJJMQLSA-N |
| XLogP | 4.05 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|