About 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid
2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid (PubChem CID 56642931) has the molecular formula C9H13N5O4
and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid.
Molecular Properties
| Compound Name | 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid |
| PubChem CID | 56642931 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid |
| SMILES | COc1ccc(/C=N\N=C(N)N)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C9H12N4O.HNO3/c1-14-8-4-2-7(3-5-8)6-12-13-9(10)11;2-1(3)4/h2-6H,1H3,(H4,10,11,13);(H,2,3,4)/b12-6-; |
| InChIKey | UMKRVZBPLQUNOM-DAMYXMBDSA-N |
| XLogP | -0.05 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid?
The IUPAC name of 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid (CID 56642931) is 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid.
What is the SMILES notation for 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid?
The canonical SMILES for 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid is COc1ccc(/C=N\N=C(N)N)cc1.O=[N+]([O-])O.
What is the InChIKey of 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid?
The InChIKey is UMKRVZBPLQUNOM-DAMYXMBDSA-N. The full InChI is InChI=1S/C9H12N4O.HNO3/c1-14-8-4-2-7(3-5-8)6-12-13-9(10)11;2-1(3)4/h2-6H,1H3,(H4,10,11,13);(H,2,3,4)/b12-6-;.
What are the key properties of 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid?
2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid has a molecular weight of 255.23 g/mol, XLogP of -0.05, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-(4-methoxyphenyl)methylideneamino]guanidine;nitric acid is sourced from PubChem (CID 56642931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).