C18H20Cl2N6O2 — CID 56642934
3-N-[(E)-[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 56642934) has the molecular formula C18H20Cl2N6O2 and a molecular weight of 423.30 g/mol. Its IUPAC name is 3-N-[(E)-[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(E)-[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 56642934 |
| Molecular Formula | C18H20Cl2N6O2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-N-[(E)-[2-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | COc1cccc(/C=N/Nc2nnc(C)n2N)c1OCc1ccccc1Cl.Cl |
| InChI | InChI=1S/C18H19ClN6O2.ClH/c1-12-22-24-18(25(12)20)23-21-10-13-7-5-9-16(26-2)17(13)27-11-14-6-3-4-8-15(14)19;/h3-10H,11,20H2,1-2H3,(H,23,24);1H/b21-10+; |
| InChIKey | NYEYTZMPTALLEP-FYEZMLSJSA-N |
| XLogP | 3.41 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|