C24H22N4O2 — CID 56642966
N-[(E)-(2-methoxyphenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide (PubChem CID 56642966) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[(E)-(2-methoxyphenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide.
| Compound Name | N-[(E)-(2-methoxyphenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56642966 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[(E)-(2-methoxyphenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide |
| SMILES | COc1ccccc1/C=N/NC(=O)C1=NNC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C24H22N4O2/c1-30-22-15-9-8-10-18(22)17-25-27-23(29)21-16-24(28-26-21,19-11-4-2-5-12-19)20-13-6-3-7-14-20/h2-15,17,28H,16H2,1H3,(H,27,29)/b25-17+ |
| InChIKey | RJEYCXHLEGVJBC-KOEQRZSOSA-N |
| XLogP | 3.44 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|