About 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid
5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid (PubChem CID 56643007) has the molecular formula C22H19F2NO4S
and a molecular weight of 431.46 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid |
| PubChem CID | 56643007 |
| Molecular Formula | C22H19F2NO4S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2cc(NC(=O)c3c(F)cccc3F)c(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C22H19F2NO4S/c1-2-3-11-29-14-9-7-13(8-10-14)18-12-17(20(30-18)22(27)28)25-21(26)19-15(23)5-4-6-16(19)24/h4-10,12H,2-3,11H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | WEBOHTNXZFUPNI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid?
The IUPAC name of 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid (CID 56643007) is 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid?
The canonical SMILES for 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid is CCCCOc1ccc(-c2cc(NC(=O)c3c(F)cccc3F)c(C(=O)O)s2)cc1.
What is the InChIKey of 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid?
The InChIKey is WEBOHTNXZFUPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2NO4S/c1-2-3-11-29-14-9-7-13(8-10-14)18-12-17(20(30-18)22(27)28)25-21(26)19-15(23)5-4-6-16(19)24/h4-10,12H,2-3,11H2,1H3,(H,25,26)(H,27,28).
What are the key properties of 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid?
5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid has a molecular weight of 431.46 g/mol, XLogP of 5.82, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-butoxyphenyl)-3-[(2,6-difluorobenzoyl)amino]thiophene-2-carboxylic acid is sourced from PubChem (CID 56643007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).