C22H18F3NO4S — CID 56643018
5-(4-butoxyphenyl)-3-[(2,4,6-trifluorobenzoyl)amino]thiophene-2-carboxylic acid (PubChem CID 56643018) has the molecular formula C22H18F3NO4S and a molecular weight of 449.45 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-3-[(2,4,6-trifluorobenzoyl)amino]thiophene-2-carboxylic acid.
| Compound Name | 5-(4-butoxyphenyl)-3-[(2,4,6-trifluorobenzoyl)amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 56643018 |
| Molecular Formula | C22H18F3NO4S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 5-(4-butoxyphenyl)-3-[(2,4,6-trifluorobenzoyl)amino]thiophene-2-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2cc(NC(=O)c3c(F)cc(F)cc3F)c(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C22H18F3NO4S/c1-2-3-8-30-14-6-4-12(5-7-14)18-11-17(20(31-18)22(28)29)26-21(27)19-15(24)9-13(23)10-16(19)25/h4-7,9-11H,2-3,8H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | NFQBYRDVIMFMEE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|