C20H26F3N3O9S — CID 56643190
[2-[4-(2-methylpropyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate;2,2,2-trifluoroacetic acid (PubChem CID 56643190) has the molecular formula C20H26F3N3O9S and a molecular weight of 541.50 g/mol. Its IUPAC name is [2-[4-(2-methylpropyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate;2,2,2-trifluoroacetic acid.
| Compound Name | [2-[4-(2-methylpropyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 56643190 |
| Molecular Formula | C20H26F3N3O9S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | [2-[4-(2-methylpropyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)CN1CCN(C(=O)COC(=O)c2ccc(S(C)(=O)=O)c([N+](=O)[O-])c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N3O7S.C2HF3O2/c1-13(2)11-19-6-8-20(9-7-19)17(22)12-28-18(23)14-4-5-16(29(3,26)27)15(10-14)21(24)25;3-2(4,5)1(6)7/h4-5,10,13H,6-9,11-12H2,1-3H3;(H,6,7) |
| InChIKey | GURFQDMDRFUPME-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 164.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|