C19H18F3IN2O4 — CID 56643272
(2-iodophenyl)-(4-pyridin-3-yloxypiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 56643272) has the molecular formula C19H18F3IN2O4 and a molecular weight of 522.26 g/mol. Its IUPAC name is (2-iodophenyl)-(4-pyridin-3-yloxypiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (2-iodophenyl)-(4-pyridin-3-yloxypiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 56643272 |
| Molecular Formula | C19H18F3IN2O4 |
| Molecular Weight | 522.26 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | (2-iodophenyl)-(4-pyridin-3-yloxypiperidin-1-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccccc1I)N1CCC(Oc2cccnc2)CC1 |
| InChI | InChI=1S/C17H17IN2O2.C2HF3O2/c18-16-6-2-1-5-15(16)17(21)20-10-7-13(8-11-20)22-14-4-3-9-19-12-14;3-2(4,5)1(6)7/h1-6,9,12-13H,7-8,10-11H2;(H,6,7) |
| InChIKey | CTNGCPLRLINXJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|