C25H22N2O6 — CID 56644700
4-[4-hydroxy-3-(2-hydroxyethoxy)-5-nitrophenyl]-5,6-diphenyl-3,4-dihydro-1H-pyridin-2-one (PubChem CID 56644700) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is 4-[4-hydroxy-3-(2-hydroxyethoxy)-5-nitrophenyl]-5,6-diphenyl-3,4-dihydro-1H-pyridin-2-one.
| Compound Name | 4-[4-hydroxy-3-(2-hydroxyethoxy)-5-nitrophenyl]-5,6-diphenyl-3,4-dihydro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 56644700 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 4-[4-hydroxy-3-(2-hydroxyethoxy)-5-nitrophenyl]-5,6-diphenyl-3,4-dihydro-1H-pyridin-2-one |
| SMILES | O=C1CC(c2cc(OCCO)c(O)c([N+](=O)[O-])c2)C(c2ccccc2)=C(c2ccccc2)N1 |
| InChI | InChI=1S/C25H22N2O6/c28-11-12-33-21-14-18(13-20(25(21)30)27(31)32)19-15-22(29)26-24(17-9-5-2-6-10-17)23(19)16-7-3-1-4-8-16/h1-10,13-14,19,28,30H,11-12,15H2,(H,26,29) |
| InChIKey | QQNMPVMAYGGUPS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|