C31H25F6N3O7 — CID 56644900
N-(6-hydroxyhexyl)-1-oxo-3',6'-bis[(2,2,2-trifluoroacetyl)amino]spiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 56644900) has the molecular formula C31H25F6N3O7 and a molecular weight of 665.54 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-1-oxo-3',6'-bis[(2,2,2-trifluoroacetyl)amino]spiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | N-(6-hydroxyhexyl)-1-oxo-3',6'-bis[(2,2,2-trifluoroacetyl)amino]spiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 56644900 |
| Molecular Formula | C31H25F6N3O7 |
| Molecular Weight | 665.54 g/mol |
| Exact Mass | 665.16 |
| IUPAC Name | N-(6-hydroxyhexyl)-1-oxo-3',6'-bis[(2,2,2-trifluoroacetyl)amino]spiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | O=C(NCCCCCCO)c1ccc2c(c1)C1(OC2=O)c2ccc(NC(=O)C(F)(F)F)cc2Oc2cc(NC(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C31H25F6N3O7/c32-30(33,34)27(44)39-17-6-9-20-23(14-17)46-24-15-18(40-28(45)31(35,36)37)7-10-21(24)29(20)22-13-16(5-8-19(22)26(43)47-29)25(42)38-11-3-1-2-4-12-41/h5-10,13-15,41H,1-4,11-12H2,(H,38,42)(H,39,44)(H,40,45) |
| InChIKey | PKISLIZJVLHJIB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|