C37H37F6N3O7 — CID 56645100
3',6'-bis[ethyl-(2,2,2-trifluoroacetyl)amino]-N-(6-hydroxyhexyl)-2',7'-dimethyl-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide (PubChem CID 56645100) has the molecular formula C37H37F6N3O7 and a molecular weight of 749.70 g/mol. Its IUPAC name is 3',6'-bis[ethyl-(2,2,2-trifluoroacetyl)amino]-N-(6-hydroxyhexyl)-2',7'-dimethyl-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide.
| Compound Name | 3',6'-bis[ethyl-(2,2,2-trifluoroacetyl)amino]-N-(6-hydroxyhexyl)-2',7'-dimethyl-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
|---|---|
| PubChem CID | 56645100 |
| Molecular Formula | C37H37F6N3O7 |
| Molecular Weight | 749.70 g/mol |
| Exact Mass | 749.25 |
| IUPAC Name | 3',6'-bis[ethyl-(2,2,2-trifluoroacetyl)amino]-N-(6-hydroxyhexyl)-2',7'-dimethyl-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxamide |
| SMILES | CCN(C(=O)C(F)(F)F)c1cc2c(cc1C)C1(OC(=O)c3ccc(C(=O)NCCCCCCO)cc31)c1cc(C)c(N(CC)C(=O)C(F)(F)F)cc1O2 |
| InChI | InChI=1S/C37H37F6N3O7/c1-5-45(33(50)36(38,39)40)27-18-29-25(15-20(27)3)35(26-16-21(4)28(19-30(26)52-29)46(6-2)34(51)37(41,42)43)24-17-22(11-12-23(24)32(49)53-35)31(48)44-13-9-7-8-10-14-47/h11-12,15-19,47H,5-10,13-14H2,1-4H3,(H,44,48) |
| InChIKey | NIWKJHBONQHMBX-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|