C20H16BrCl3F3N3O2 — CID 56645333
4-bromo-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]butanehydrazide (PubChem CID 56645333) has the molecular formula C20H16BrCl3F3N3O2 and a molecular weight of 573.62 g/mol. Its IUPAC name is 4-bromo-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]butanehydrazide.
| Compound Name | 4-bromo-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]butanehydrazide |
|---|---|
| PubChem CID | 56645333 |
| Molecular Formula | C20H16BrCl3F3N3O2 |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 570.94 |
| IUPAC Name | 4-bromo-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]butanehydrazide |
| SMILES | O=C(CCCBr)NNc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C20H16BrCl3F3N3O2/c21-5-1-2-18(31)29-28-16-6-11(3-4-15(16)24)17-10-19(32-30-17,20(25,26)27)12-7-13(22)9-14(23)8-12/h3-4,6-9,28H,1-2,5,10H2,(H,29,31) |
| InChIKey | GUXQASCWQSJOSJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|