C21H18Cl4F3N3O2 — CID 56645334
3-chloro-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2,2-dimethylpropanehydrazide (PubChem CID 56645334) has the molecular formula C21H18Cl4F3N3O2 and a molecular weight of 543.20 g/mol. Its IUPAC name is 3-chloro-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2,2-dimethylpropanehydrazide.
| Compound Name | 3-chloro-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 56645334 |
| Molecular Formula | C21H18Cl4F3N3O2 |
| Molecular Weight | 543.20 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | 3-chloro-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2,2-dimethylpropanehydrazide |
| SMILES | CC(C)(CCl)C(=O)NNc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C21H18Cl4F3N3O2/c1-19(2,10-22)18(32)30-29-16-5-11(3-4-15(16)25)17-9-20(33-31-17,21(26,27)28)12-6-13(23)8-14(24)7-12/h3-8,29H,9-10H2,1-2H3,(H,30,32) |
| InChIKey | NOYHHDNKGHJGJP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.20 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|