C18H12BrCl3F3N3O2 — CID 56645335
2-bromo-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]acetohydrazide (PubChem CID 56645335) has the molecular formula C18H12BrCl3F3N3O2 and a molecular weight of 545.57 g/mol. Its IUPAC name is 2-bromo-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]acetohydrazide.
| Compound Name | 2-bromo-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 56645335 |
| Molecular Formula | C18H12BrCl3F3N3O2 |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 542.91 |
| IUPAC Name | 2-bromo-N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]acetohydrazide |
| SMILES | O=C(CBr)NNc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C18H12BrCl3F3N3O2/c19-8-16(29)27-26-14-3-9(1-2-13(14)22)15-7-17(30-28-15,18(23,24)25)10-4-11(20)6-12(21)5-10/h1-6,26H,7-8H2,(H,27,29) |
| InChIKey | ANLDKQHQUHHPSG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|