C21H17Cl2F6N3O2 — CID 56645336
N'-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-ethylphenyl]-3,3,3-trifluoropropanehydrazide (PubChem CID 56645336) has the molecular formula C21H17Cl2F6N3O2 and a molecular weight of 528.28 g/mol. Its IUPAC name is N'-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-ethylphenyl]-3,3,3-trifluoropropanehydrazide.
| Compound Name | N'-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-ethylphenyl]-3,3,3-trifluoropropanehydrazide |
|---|---|
| PubChem CID | 56645336 |
| Molecular Formula | C21H17Cl2F6N3O2 |
| Molecular Weight | 528.28 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | N'-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-ethylphenyl]-3,3,3-trifluoropropanehydrazide |
| SMILES | CCc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1NNC(=O)CC(F)(F)F |
| InChI | InChI=1S/C21H17Cl2F6N3O2/c1-2-11-3-4-12(5-16(11)30-31-18(33)10-20(24,25)26)17-9-19(34-32-17,21(27,28)29)13-6-14(22)8-15(23)7-13/h3-8,30H,2,9-10H2,1H3,(H,31,33) |
| InChIKey | BQSIDNOZIIYRNQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.28 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|