C20H16N4O3 — CID 56645381
1-[4-(3-hydroxyphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]piperidin-4-one (PubChem CID 56645381) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 1-[4-(3-hydroxyphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]piperidin-4-one.
| Compound Name | 1-[4-(3-hydroxyphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]piperidin-4-one |
|---|---|
| PubChem CID | 56645381 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-[4-(3-hydroxyphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]piperidin-4-one |
| SMILES | O=C1CCN(c2nc(-c3cccc(O)c3)nc3c2oc2ncccc23)CC1 |
| InChI | InChI=1S/C20H16N4O3/c25-13-6-9-24(10-7-13)19-17-16(15-5-2-8-21-20(15)27-17)22-18(23-19)12-3-1-4-14(26)11-12/h1-5,8,11,26H,6-7,9-10H2 |
| InChIKey | WGIKLJIFJRRCPX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |