About 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide
2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide (PubChem CID 56645421) has the molecular formula C19H17N7O2
and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide |
| PubChem CID | 56645421 |
| Molecular Formula | C19H17N7O2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ncc(C(N)=O)o3)n2)ccc1N1CCCC1 |
| InChI | InChI=1S/C19H17N7O2/c20-10-13-9-12(3-4-15(13)26-7-1-2-8-26)14-5-6-22-18(24-14)25-19-23-11-16(28-19)17(21)27/h3-6,9,11H,1-2,7-8H2,(H2,21,27)(H,22,23,24,25) |
| InChIKey | ZCXMVWPGUUGVQV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide?
The IUPAC name of 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide (CID 56645421) is 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide.
What is the SMILES notation for 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide?
The canonical SMILES for 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide is N#Cc1cc(-c2ccnc(Nc3ncc(C(N)=O)o3)n2)ccc1N1CCCC1.
What is the InChIKey of 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide?
The InChIKey is ZCXMVWPGUUGVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N7O2/c20-10-13-9-12(3-4-15(13)26-7-1-2-8-26)14-5-6-22-18(24-14)25-19-23-11-16(28-19)17(21)27/h3-6,9,11H,1-2,7-8H2,(H2,21,27)(H,22,23,24,25).
What are the key properties of 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide?
2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide has a molecular weight of 375.39 g/mol, XLogP of 2.45, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3-cyano-4-pyrrolidin-1-ylphenyl)pyrimidin-2-yl]amino]-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 56645421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).