C18H14Cl2F3N3O2 — CID 56645445
N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]acetohydrazide (PubChem CID 56645445) has the molecular formula C18H14Cl2F3N3O2 and a molecular weight of 432.23 g/mol. Its IUPAC name is N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]acetohydrazide.
| Compound Name | N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 56645445 |
| Molecular Formula | C18H14Cl2F3N3O2 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]acetohydrazide |
| SMILES | CC(=O)NNc1cccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C18H14Cl2F3N3O2/c1-10(27)24-25-15-4-2-3-11(5-15)16-9-17(28-26-16,18(21,22)23)12-6-13(19)8-14(20)7-12/h2-8,25H,9H2,1H3,(H,24,27) |
| InChIKey | DHGPOYAFIZIVGC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|