C27H27N7O — CID 56645498
(10Z)-13-methyl-6-(3-methyl-1,2,4-triazol-1-yl)-18-phenyl-8-oxa-2,13,20,21-tetrazatetracyclo[12.6.1.13,7.015,19]docosa-1(20),3(22),4,6,10,14(21),15(19)-heptaene (PubChem CID 56645498) has the molecular formula C27H27N7O and a molecular weight of 465.56 g/mol. Its IUPAC name is (10Z)-13-methyl-6-(3-methyl-1,2,4-triazol-1-yl)-18-phenyl-8-oxa-2,13,20,21-tetrazatetracyclo[12.6.1.13,7.015,19]docosa-1(20),3(22),4,6,10,14(21),15(19)-heptaene.
| Compound Name | (10Z)-13-methyl-6-(3-methyl-1,2,4-triazol-1-yl)-18-phenyl-8-oxa-2,13,20,21-tetrazatetracyclo[12.6.1.13,7.015,19]docosa-1(20),3(22),4,6,10,14(21),15(19)-heptaene |
|---|---|
| PubChem CID | 56645498 |
| Molecular Formula | C27H27N7O |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (10Z)-13-methyl-6-(3-methyl-1,2,4-triazol-1-yl)-18-phenyl-8-oxa-2,13,20,21-tetrazatetracyclo[12.6.1.13,7.015,19]docosa-1(20),3(22),4,6,10,14(21),15(19)-heptaene |
| SMILES | Cc1ncn(-c2ccc3cc2OC/C=C\CN(C)c2nc(nc4c2CCC4c2ccccc2)N3)n1 |
| InChI | InChI=1S/C27H27N7O/c1-18-28-17-34(32-18)23-13-10-20-16-24(23)35-15-7-6-14-33(2)26-22-12-11-21(19-8-4-3-5-9-19)25(22)30-27(29-20)31-26/h3-10,13,16-17,21H,11-12,14-15H2,1-2H3,(H,29,30,31)/b7-6- |
| InChIKey | VWJZHWMHONNLEM-SREVYHEPSA-N |
| XLogP | 4.57 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|