C17H26N2O5 — CID 56645626
(2S)-2-[3-[2-(2-hydroxyethoxy)ethylamino]butanoylamino]-3-phenylpropanoic acid (PubChem CID 56645626) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2S)-2-[3-[2-(2-hydroxyethoxy)ethylamino]butanoylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[3-[2-(2-hydroxyethoxy)ethylamino]butanoylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 56645626 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2S)-2-[3-[2-(2-hydroxyethoxy)ethylamino]butanoylamino]-3-phenylpropanoic acid |
| SMILES | CC(CC(=O)N[C@@H](Cc1ccccc1)C(=O)O)NCCOCCO |
| InChI | InChI=1S/C17H26N2O5/c1-13(18-7-9-24-10-8-20)11-16(21)19-15(17(22)23)12-14-5-3-2-4-6-14/h2-6,13,15,18,20H,7-12H2,1H3,(H,19,21)(H,22,23)/t13?,15-/m0/s1 |
| InChIKey | ATMNSESIDPTQKU-WUJWULDRSA-N |
| XLogP | 0.18 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|