About 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile
5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile (PubChem CID 56645631) has the molecular formula C18H16N6O
and a molecular weight of 332.37 g/mol. Its IUPAC name is 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile.
Molecular Properties
| Compound Name | 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile |
| PubChem CID | 56645631 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ncco3)n2)ccc1N1CCCC1 |
| InChI | InChI=1S/C18H16N6O/c19-12-14-11-13(3-4-16(14)24-8-1-2-9-24)15-5-6-20-17(22-15)23-18-21-7-10-25-18/h3-7,10-11H,1-2,8-9H2,(H,20,21,22,23) |
| InChIKey | NOSXZTRDDMBTGQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile?
The IUPAC name of 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile (CID 56645631) is 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile.
What is the SMILES notation for 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile?
The canonical SMILES for 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile is N#Cc1cc(-c2ccnc(Nc3ncco3)n2)ccc1N1CCCC1.
What is the InChIKey of 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile?
The InChIKey is NOSXZTRDDMBTGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O/c19-12-14-11-13(3-4-16(14)24-8-1-2-9-24)15-5-6-20-17(22-15)23-18-21-7-10-25-18/h3-7,10-11H,1-2,8-9H2,(H,20,21,22,23).
What are the key properties of 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile?
5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile has a molecular weight of 332.37 g/mol, XLogP of 3.35, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,3-oxazol-2-ylamino)pyrimidin-4-yl]-2-pyrrolidin-1-ylbenzonitrile is sourced from PubChem (CID 56645631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).