C19H13Cl2F6N3O2 — CID 56645659
N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-3,3,3-trifluoropropanehydrazide (PubChem CID 56645659) has the molecular formula C19H13Cl2F6N3O2 and a molecular weight of 500.23 g/mol. Its IUPAC name is N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-3,3,3-trifluoropropanehydrazide.
| Compound Name | N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-3,3,3-trifluoropropanehydrazide |
|---|---|
| PubChem CID | 56645659 |
| Molecular Formula | C19H13Cl2F6N3O2 |
| Molecular Weight | 500.23 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | N'-[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-3,3,3-trifluoropropanehydrazide |
| SMILES | O=C(CC(F)(F)F)NNc1cccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C19H13Cl2F6N3O2/c20-12-5-11(6-13(21)7-12)17(19(25,26)27)8-15(30-32-17)10-2-1-3-14(4-10)28-29-16(31)9-18(22,23)24/h1-7,28H,8-9H2,(H,29,31) |
| InChIKey | NNLNCJQLGRLEPQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.23 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|