About 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one
6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one (PubChem CID 56645737) has the molecular formula C17H13NO5
and a molecular weight of 311.29 g/mol. Its IUPAC name is 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one.
Molecular Properties
| Compound Name | 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
| PubChem CID | 56645737 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
| SMILES | COc1cc(O)cc(-c2cc(=O)c3cc4c(cc3[nH]2)OCO4)c1 |
| InChI | InChI=1S/C17H13NO5/c1-21-11-3-9(2-10(19)4-11)13-6-15(20)12-5-16-17(23-8-22-16)7-14(12)18-13/h2-7,19H,8H2,1H3,(H,18,20) |
| InChIKey | MHTATBQNQJVCME-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one?
The IUPAC name of 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one (CID 56645737) is 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one.
What is the SMILES notation for 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one?
The canonical SMILES for 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one is COc1cc(O)cc(-c2cc(=O)c3cc4c(cc3[nH]2)OCO4)c1.
What is the InChIKey of 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one?
The InChIKey is MHTATBQNQJVCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO5/c1-21-11-3-9(2-10(19)4-11)13-6-15(20)12-5-16-17(23-8-22-16)7-14(12)18-13/h2-7,19H,8H2,1H3,(H,18,20).
What are the key properties of 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one?
6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one has a molecular weight of 311.29 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-hydroxy-5-methoxyphenyl)-5H-[1,3]dioxolo[4,5-g]quinolin-8-one is sourced from PubChem (CID 56645737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).