C20H17Cl3F3N3O2 — CID 56645753
N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]butanehydrazide (PubChem CID 56645753) has the molecular formula C20H17Cl3F3N3O2 and a molecular weight of 494.73 g/mol. Its IUPAC name is N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]butanehydrazide.
| Compound Name | N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]butanehydrazide |
|---|---|
| PubChem CID | 56645753 |
| Molecular Formula | C20H17Cl3F3N3O2 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]butanehydrazide |
| SMILES | CCCC(=O)NNc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C20H17Cl3F3N3O2/c1-2-3-18(30)28-27-16-6-11(4-5-15(16)23)17-10-19(31-29-17,20(24,25)26)12-7-13(21)9-14(22)8-12/h4-9,27H,2-3,10H2,1H3,(H,28,30) |
| InChIKey | CJLYNSNVCIZFJT-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|