C21H19Cl3F3N3O2 — CID 56645947
N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]pentanehydrazide (PubChem CID 56645947) has the molecular formula C21H19Cl3F3N3O2 and a molecular weight of 508.76 g/mol. Its IUPAC name is N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]pentanehydrazide.
| Compound Name | N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]pentanehydrazide |
|---|---|
| PubChem CID | 56645947 |
| Molecular Formula | C21H19Cl3F3N3O2 |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | N'-[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]pentanehydrazide |
| SMILES | CCCCC(=O)NNc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C21H19Cl3F3N3O2/c1-2-3-4-19(31)29-28-17-7-12(5-6-16(17)24)18-11-20(32-30-18,21(25,26)27)13-8-14(22)10-15(23)9-13/h5-10,28H,2-4,11H2,1H3,(H,29,31) |
| InChIKey | XOXOWIIGPOOYSK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|