C28H29F3N2O6S — CID 56646747
2-[3-[[2-(benzenesulfonamido)-5-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl]acetic acid (PubChem CID 56646747) has the molecular formula C28H29F3N2O6S and a molecular weight of 578.61 g/mol. Its IUPAC name is 2-[3-[[2-(benzenesulfonamido)-5-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl]acetic acid.
| Compound Name | 2-[3-[[2-(benzenesulfonamido)-5-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 56646747 |
| Molecular Formula | C28H29F3N2O6S |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 2-[3-[[2-(benzenesulfonamido)-5-(2,2,2-trifluoroethoxy)phenyl]methyl]-2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2cc(OCC(F)(F)F)ccc2NS(=O)(=O)c2ccccc2)c2c(n1CC(=O)O)CC(C)(C)CC2=O |
| InChI | InChI=1S/C28H29F3N2O6S/c1-17-21(26-23(33(17)15-25(35)36)13-27(2,3)14-24(26)34)12-18-11-19(39-16-28(29,30)31)9-10-22(18)32-40(37,38)20-7-5-4-6-8-20/h4-11,32H,12-16H2,1-3H3,(H,35,36) |
| InChIKey | WNTMBMQKTCSLQU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |