C22H27ClOSi — CID 56646883
tert-butyl-[[(1R,2S)-2-(4-chlorophenyl)-3-methylidene-1,2-dihydroinden-1-yl]oxy]-dimethylsilane (PubChem CID 56646883) has the molecular formula C22H27ClOSi and a molecular weight of 371.00 g/mol. Its IUPAC name is tert-butyl-[[(1R,2S)-2-(4-chlorophenyl)-3-methylidene-1,2-dihydroinden-1-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2S)-2-(4-chlorophenyl)-3-methylidene-1,2-dihydroinden-1-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 56646883 |
| Molecular Formula | C22H27ClOSi |
| Molecular Weight | 371.00 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | tert-butyl-[[(1R,2S)-2-(4-chlorophenyl)-3-methylidene-1,2-dihydroinden-1-yl]oxy]-dimethylsilane |
| SMILES | C=C1c2ccccc2[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClOSi/c1-15-18-9-7-8-10-19(18)21(24-25(5,6)22(2,3)4)20(15)16-11-13-17(23)14-12-16/h7-14,20-21H,1H2,2-6H3/t20-,21+/m1/s1 |
| InChIKey | PWMSLNNIORJCQJ-RTWAWAEBSA-N |
| XLogP | 7.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.00 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|