C24H31F2N7 — CID 56646927
6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[2-(3-fluorophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 56646927) has the molecular formula C24H31F2N7 and a molecular weight of 455.56 g/mol. Its IUPAC name is 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[2-(3-fluorophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[2-(3-fluorophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 56646927 |
| Molecular Formula | C24H31F2N7 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 6-N-[3-(dimethylamino)propyl]-2-N,4-N-bis[2-(3-fluorophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)CCCNc1nc(NCCc2cccc(F)c2)nc(NCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C24H31F2N7/c1-33(2)15-5-12-27-22-30-23(28-13-10-18-6-3-8-20(25)16-18)32-24(31-22)29-14-11-19-7-4-9-21(26)17-19/h3-4,6-9,16-17H,5,10-15H2,1-2H3,(H3,27,28,29,30,31,32) |
| InChIKey | IACBZFUKAMSSMP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|