C10H9BrO3 — CID 56646943
(1S,10R)-4-bromo-8,12,13-trioxatricyclo[8.2.1.02,7]trideca-2(7),3,5-triene (PubChem CID 56646943) has the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. Its IUPAC name is (1S,10R)-4-bromo-8,12,13-trioxatricyclo[8.2.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (1S,10R)-4-bromo-8,12,13-trioxatricyclo[8.2.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 56646943 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | (1S,10R)-4-bromo-8,12,13-trioxatricyclo[8.2.1.02,7]trideca-2(7),3,5-triene |
| SMILES | Brc1ccc2c(c1)[C@H]1OC[C@@H](CO2)O1 |
| InChI | InChI=1S/C10H9BrO3/c11-6-1-2-9-8(3-6)10-13-5-7(14-10)4-12-9/h1-3,7,10H,4-5H2/t7-,10+/m1/s1 |
| InChIKey | ONIPDYPKHKYOAW-XCBNKYQSSA-N |
| XLogP | 2.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |