C27H38ClN5O4S — CID 56646975
4-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]butanoic acid (PubChem CID 56646975) has the molecular formula C27H38ClN5O4S and a molecular weight of 564.15 g/mol. Its IUPAC name is 4-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]butanoic acid.
| Compound Name | 4-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 56646975 |
| Molecular Formula | C27H38ClN5O4S |
| Molecular Weight | 564.15 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 4-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]butanoic acid |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCC[C@@H](C)N1CCC(N(Cc2ccsc2)C(=O)NCCCC(=O)O)CC1 |
| InChI | InChI=1S/C27H38ClN5O4S/c1-18-15-23(28)31-20(3)25(18)26(36)29-11-6-19(2)32-12-7-22(8-13-32)33(16-21-9-14-38-17-21)27(37)30-10-4-5-24(34)35/h9,14-15,17,19,22H,4-8,10-13,16H2,1-3H3,(H,29,36)(H,30,37)(H,34,35)/t19-/m1/s1 |
| InChIKey | VPJBCWCQFZDBTK-LJQANCHMSA-N |
| XLogP | 4.46 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.15 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|