C28H41ClN6O3S — CID 56646976
6-chloro-2,4-dimethyl-N-[(3R)-3-[4-[[4-(methylamino)-4-oxobutyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridine-3-carboxamide (PubChem CID 56646976) has the molecular formula C28H41ClN6O3S and a molecular weight of 577.20 g/mol. Its IUPAC name is 6-chloro-2,4-dimethyl-N-[(3R)-3-[4-[[4-(methylamino)-4-oxobutyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-2,4-dimethyl-N-[(3R)-3-[4-[[4-(methylamino)-4-oxobutyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56646976 |
| Molecular Formula | C28H41ClN6O3S |
| Molecular Weight | 577.20 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 6-chloro-2,4-dimethyl-N-[(3R)-3-[4-[[4-(methylamino)-4-oxobutyl]carbamoyl-(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]pyridine-3-carboxamide |
| SMILES | CNC(=O)CCCNC(=O)N(Cc1ccsc1)C1CCN([C@H](C)CCNC(=O)c2c(C)cc(Cl)nc2C)CC1 |
| InChI | InChI=1S/C28H41ClN6O3S/c1-19-16-24(29)33-21(3)26(19)27(37)31-12-7-20(2)34-13-8-23(9-14-34)35(17-22-10-15-39-18-22)28(38)32-11-5-6-25(36)30-4/h10,15-16,18,20,23H,5-9,11-14,17H2,1-4H3,(H,30,36)(H,31,37)(H,32,38)/t20-/m1/s1 |
| InChIKey | HFMINNRJWTYEAA-HXUWFJFHSA-N |
| XLogP | 4.12 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|