C28H40ClN5O4S — CID 56647019
5-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]pentanoic acid (PubChem CID 56647019) has the molecular formula C28H40ClN5O4S and a molecular weight of 578.18 g/mol. Its IUPAC name is 5-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]pentanoic acid.
| Compound Name | 5-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 56647019 |
| Molecular Formula | C28H40ClN5O4S |
| Molecular Weight | 578.18 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 5-[[[1-[(2R)-4-[(6-chloro-2,4-dimethylpyridine-3-carbonyl)amino]butan-2-yl]piperidin-4-yl]-(thiophen-3-ylmethyl)carbamoyl]amino]pentanoic acid |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCC[C@@H](C)N1CCC(N(Cc2ccsc2)C(=O)NCCCCC(=O)O)CC1 |
| InChI | InChI=1S/C28H40ClN5O4S/c1-19-16-24(29)32-21(3)26(19)27(37)30-12-7-20(2)33-13-8-23(9-14-33)34(17-22-10-15-39-18-22)28(38)31-11-5-4-6-25(35)36/h10,15-16,18,20,23H,4-9,11-14,17H2,1-3H3,(H,30,37)(H,31,38)(H,35,36)/t20-/m1/s1 |
| InChIKey | QIXQLHIFDXGXNQ-HXUWFJFHSA-N |
| XLogP | 4.85 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|