C21H23NO2 — CID 56647308
(2R,3S,6R)-3-ethenyl-3,7,7,10-tetramethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),8,11,13-tetraene-4,16-dione (PubChem CID 56647308) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2R,3S,6R)-3-ethenyl-3,7,7,10-tetramethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),8,11,13-tetraene-4,16-dione.
| Compound Name | (2R,3S,6R)-3-ethenyl-3,7,7,10-tetramethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),8,11,13-tetraene-4,16-dione |
|---|---|
| PubChem CID | 56647308 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2R,3S,6R)-3-ethenyl-3,7,7,10-tetramethyl-10-azatetracyclo[6.6.1.12,6.011,15]hexadeca-1(15),8,11,13-tetraene-4,16-dione |
| SMILES | C=C[C@]1(C)C(=O)C[C@H]2C(=O)[C@@H]1c1cccc3c1c(cn3C)C2(C)C |
| InChI | InChI=1S/C21H23NO2/c1-6-21(4)16(23)10-13-19(24)18(21)12-8-7-9-15-17(12)14(11-22(15)5)20(13,2)3/h6-9,11,13,18H,1,10H2,2-5H3/t13-,18-,21+/m0/s1 |
| InChIKey | WZRUBMQOCYOVSS-LTBCBRHQSA-N |
| XLogP | 3.90 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|