C24H45NO8 — CID 56647343
(2S)-N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxan-2-yl]methyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyloxan-2-yl]acetamide (PubChem CID 56647343) has the molecular formula C24H45NO8 and a molecular weight of 475.62 g/mol. Its IUPAC name is (2S)-N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxan-2-yl]methyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyloxan-2-yl]acetamide.
| Compound Name | (2S)-N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxan-2-yl]methyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyloxan-2-yl]acetamide |
|---|---|
| PubChem CID | 56647343 |
| Molecular Formula | C24H45NO8 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.31 |
| IUPAC Name | (2S)-N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxan-2-yl]methyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyloxan-2-yl]acetamide |
| SMILES | COC[C@H](C[C@H]1O[C@H](CNC(=O)[C@@H](O)[C@@]2(OC)CC[C@@H](C)[C@@H](C)O2)C[C@@H](OC)C1(C)C)OC |
| InChI | InChI=1S/C24H45NO8/c1-15-9-10-24(31-8,33-16(15)2)21(26)22(27)25-13-17-11-19(30-7)23(3,4)20(32-17)12-18(29-6)14-28-5/h15-21,26H,9-14H2,1-8H3,(H,25,27)/t15-,16-,17+,18+,19-,20-,21-,24-/m1/s1 |
| InChIKey | JNXRMSHSNDQJCP-CCRGPOILSA-N |
| XLogP | 1.89 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |