C25H47NO8 — CID 56647401
(2S)-N-[(1R)-1-[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxan-2-yl]ethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyloxan-2-yl]acetamide (PubChem CID 56647401) has the molecular formula C25H47NO8 and a molecular weight of 489.65 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxan-2-yl]ethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyloxan-2-yl]acetamide.
| Compound Name | (2S)-N-[(1R)-1-[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxan-2-yl]ethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyloxan-2-yl]acetamide |
|---|---|
| PubChem CID | 56647401 |
| Molecular Formula | C25H47NO8 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | (2S)-N-[(1R)-1-[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyloxan-2-yl]ethyl]-2-hydroxy-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyloxan-2-yl]acetamide |
| SMILES | COC[C@H](C[C@H]1O[C@H]([C@@H](C)NC(=O)[C@@H](O)[C@@]2(OC)CC[C@@H](C)[C@@H](C)O2)C[C@@H](OC)C1(C)C)OC |
| InChI | InChI=1S/C25H47NO8/c1-15-10-11-25(32-9,34-17(15)3)22(27)23(28)26-16(2)19-13-20(31-8)24(4,5)21(33-19)12-18(30-7)14-29-6/h15-22,27H,10-14H2,1-9H3,(H,26,28)/t15-,16-,17-,18+,19+,20-,21-,22-,25-/m1/s1 |
| InChIKey | KIZFACQFMASSQP-YEGYYQPVSA-N |
| XLogP | 2.28 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |