About (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide
(2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide (PubChem CID 56647526) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide.
Molecular Properties
| Compound Name | (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide |
| PubChem CID | 56647526 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide |
| SMILES | CON(C)C(=O)[C@@H]1CCO[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C13H17NO4/c1-14(16-2)12(15)11-8-9-17-13(18-11)10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | PNAQQBIWJXVSJS-AAEUAGOBSA-N |
| XLogP | 1.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide?
The IUPAC name of (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide (CID 56647526) is (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide.
What is the SMILES notation for (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide?
The canonical SMILES for (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide is CON(C)C(=O)[C@@H]1CCO[C@H](c2ccccc2)O1.
What is the InChIKey of (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide?
The InChIKey is PNAQQBIWJXVSJS-AAEUAGOBSA-N. The full InChI is InChI=1S/C13H17NO4/c1-14(16-2)12(15)11-8-9-17-13(18-11)10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3/t11-,13-/m0/s1.
What are the key properties of (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide?
(2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide has a molecular weight of 251.28 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-N-methoxy-N-methyl-2-phenyl-1,3-dioxane-4-carboxamide is sourced from PubChem (CID 56647526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).