C26H35F2N7 — CID 56647584
6-N-[5-(dimethylamino)pentyl]-2-N,4-N-bis[2-(4-fluorophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 56647584) has the molecular formula C26H35F2N7 and a molecular weight of 483.61 g/mol. Its IUPAC name is 6-N-[5-(dimethylamino)pentyl]-2-N,4-N-bis[2-(4-fluorophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[5-(dimethylamino)pentyl]-2-N,4-N-bis[2-(4-fluorophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 56647584 |
| Molecular Formula | C26H35F2N7 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 6-N-[5-(dimethylamino)pentyl]-2-N,4-N-bis[2-(4-fluorophenyl)ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)CCCCCNc1nc(NCCc2ccc(F)cc2)nc(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C26H35F2N7/c1-35(2)19-5-3-4-16-29-24-32-25(30-17-14-20-6-10-22(27)11-7-20)34-26(33-24)31-18-15-21-8-12-23(28)13-9-21/h6-13H,3-5,14-19H2,1-2H3,(H3,29,30,31,32,33,34) |
| InChIKey | RCDIYNLTUXFQRC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|