C24H31F2N9 — CID 56647650
2-[4-[[4,6-bis[2-(4-fluorophenyl)ethylamino]-1,3,5-triazin-2-yl]amino]butyl]guanidine (PubChem CID 56647650) has the molecular formula C24H31F2N9 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-[4-[[4,6-bis[2-(4-fluorophenyl)ethylamino]-1,3,5-triazin-2-yl]amino]butyl]guanidine.
| Compound Name | 2-[4-[[4,6-bis[2-(4-fluorophenyl)ethylamino]-1,3,5-triazin-2-yl]amino]butyl]guanidine |
|---|---|
| PubChem CID | 56647650 |
| Molecular Formula | C24H31F2N9 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 2-[4-[[4,6-bis[2-(4-fluorophenyl)ethylamino]-1,3,5-triazin-2-yl]amino]butyl]guanidine |
| SMILES | NC(N)=NCCCCNc1nc(NCCc2ccc(F)cc2)nc(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C24H31F2N9/c25-19-7-3-17(4-8-19)11-15-31-23-33-22(30-14-2-1-13-29-21(27)28)34-24(35-23)32-16-12-18-5-9-20(26)10-6-18/h3-10H,1-2,11-16H2,(H4,27,28,29)(H3,30,31,32,33,34,35) |
| InChIKey | JTHOAGCTIOJIDK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|