C33H33N7O13S3 — CID 56647685
3,7,11-tris[(2-nitrophenyl)sulfonyl]-3,7,11-triazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-15-carboxamide (PubChem CID 56647685) has the molecular formula C33H33N7O13S3 and a molecular weight of 831.86 g/mol. Its IUPAC name is 3,7,11-tris[(2-nitrophenyl)sulfonyl]-3,7,11-triazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-15-carboxamide.
| Compound Name | 3,7,11-tris[(2-nitrophenyl)sulfonyl]-3,7,11-triazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-15-carboxamide |
|---|---|
| PubChem CID | 56647685 |
| Molecular Formula | C33H33N7O13S3 |
| Molecular Weight | 831.86 g/mol |
| Exact Mass | 831.13 |
| IUPAC Name | 3,7,11-tris[(2-nitrophenyl)sulfonyl]-3,7,11-triazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-15-carboxamide |
| SMILES | NC(=O)c1cc2cc(c1)CN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CCCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])CCCN(S(=O)(=O)c1ccccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C33H33N7O13S3/c34-33(41)26-20-24-19-25(21-26)23-37(56(52,53)32-14-6-3-11-29(32)40(46)47)18-8-16-35(54(48,49)30-12-4-1-9-27(30)38(42)43)15-7-17-36(22-24)55(50,51)31-13-5-2-10-28(31)39(44)45/h1-6,9-14,19-21H,7-8,15-18,22-23H2,(H2,34,41) |
| InChIKey | HQUQRSYHTUIISF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 284.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.86 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|