About methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate
methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate (PubChem CID 56647885) has the molecular formula C17H15N5O2
and a molecular weight of 321.34 g/mol. Its IUPAC name is methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate |
| PubChem CID | 56647885 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate |
| SMILES | COC(=O)/C=C/Nc1c(-c2ccccn2)n[nH]c1-c1ccccn1 |
| InChI | InChI=1S/C17H15N5O2/c1-24-14(23)8-11-20-17-15(12-6-2-4-9-18-12)21-22-16(17)13-7-3-5-10-19-13/h2-11,20H,1H3,(H,21,22)/b11-8+ |
| InChIKey | MGDRKOMPBDQHGB-DHZHZOJOSA-N |
| XLogP | 2.63 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate?
The IUPAC name of methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate (CID 56647885) is methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate?
The canonical SMILES for methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate is COC(=O)/C=C/Nc1c(-c2ccccn2)n[nH]c1-c1ccccn1.
What is the InChIKey of methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate?
The InChIKey is MGDRKOMPBDQHGB-DHZHZOJOSA-N. The full InChI is InChI=1S/C17H15N5O2/c1-24-14(23)8-11-20-17-15(12-6-2-4-9-18-12)21-22-16(17)13-7-3-5-10-19-13/h2-11,20H,1H3,(H,21,22)/b11-8+.
What are the key properties of methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate?
methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate has a molecular weight of 321.34 g/mol, XLogP of 2.63, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-[(3,5-dipyridin-2-yl-1H-pyrazol-4-yl)amino]prop-2-enoate is sourced from PubChem (CID 56647885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).