C33H37FN6O5 — CID 56648379
N-[3-[5-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-3-oxopropyl]-4-fluorobenzamide (PubChem CID 56648379) has the molecular formula C33H37FN6O5 and a molecular weight of 616.69 g/mol. Its IUPAC name is N-[3-[5-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-3-oxopropyl]-4-fluorobenzamide.
| Compound Name | N-[3-[5-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-3-oxopropyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 56648379 |
| Molecular Formula | C33H37FN6O5 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | N-[3-[5-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl]-3-oxopropyl]-4-fluorobenzamide |
| SMILES | NCCOCCOCCOCCn1nnc2c1-c1ccccc1N(C(=O)CCNC(=O)c1ccc(F)cc1)Cc1ccccc1-2 |
| InChI | InChI=1S/C33H37FN6O5/c34-26-11-9-24(10-12-26)33(42)36-15-13-30(41)39-23-25-5-1-2-6-27(25)31-32(28-7-3-4-8-29(28)39)40(38-37-31)16-18-44-20-22-45-21-19-43-17-14-35/h1-12H,13-23,35H2,(H,36,42) |
| InChIKey | ARTLIXIEHRBSFU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|