C11H12N2OS — CID 56648390
5-benzyl-3-(methylsulfanylmethyl)-1,2,4-oxadiazole (PubChem CID 56648390) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 5-benzyl-3-(methylsulfanylmethyl)-1,2,4-oxadiazole.
| Compound Name | 5-benzyl-3-(methylsulfanylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 56648390 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 5-benzyl-3-(methylsulfanylmethyl)-1,2,4-oxadiazole |
| SMILES | CSCc1noc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C11H12N2OS/c1-15-8-10-12-11(14-13-10)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | AMIRKWVFWNFDHQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |