C15H14N6O — CID 56648589
12-methoxy-5,7-dimethyl-3-(1H-pyrazol-4-yl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 56648589) has the molecular formula C15H14N6O and a molecular weight of 294.32 g/mol. Its IUPAC name is 12-methoxy-5,7-dimethyl-3-(1H-pyrazol-4-yl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 12-methoxy-5,7-dimethyl-3-(1H-pyrazol-4-yl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 56648589 |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 12-methoxy-5,7-dimethyl-3-(1H-pyrazol-4-yl)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | COc1ccc2nc(C)c3c(C)nc(-c4cn[nH]c4)n3c2n1 |
| InChI | InChI=1S/C15H14N6O/c1-8-13-9(2)19-14(10-6-16-17-7-10)21(13)15-11(18-8)4-5-12(20-15)22-3/h4-7H,1-3H3,(H,16,17) |
| InChIKey | PFHNYXFZVYZXGX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |