C17H14ClN5O — CID 56648683
3-(4-chloro-3-pyridinyl)-12-methoxy-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 56648683) has the molecular formula C17H14ClN5O and a molecular weight of 339.79 g/mol. Its IUPAC name is 3-(4-chloro-3-pyridinyl)-12-methoxy-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-(4-chloro-3-pyridinyl)-12-methoxy-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 56648683 |
| Molecular Formula | C17H14ClN5O |
| Molecular Weight | 339.79 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-(4-chloro-3-pyridinyl)-12-methoxy-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | COc1ccc2nc(C)c3c(C)nc(-c4cnccc4Cl)n3c2n1 |
| InChI | InChI=1S/C17H14ClN5O/c1-9-15-10(2)21-16(11-8-19-7-6-12(11)18)23(15)17-13(20-9)4-5-14(22-17)24-3/h4-8H,1-3H3 |
| InChIKey | LXNUCQLVMSHVOF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |